C22H20ClFN4O3 — CID 55997835
N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-3-nitro-4-(1-pyridin-2-ylethylamino)benzamide (PubChem CID 55997835) has the molecular formula C22H20ClFN4O3 and a molecular weight of 442.88 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-3-nitro-4-(1-pyridin-2-ylethylamino)benzamide.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-3-nitro-4-(1-pyridin-2-ylethylamino)benzamide |
|---|---|
| PubChem CID | 55997835 |
| Molecular Formula | C22H20ClFN4O3 |
| Molecular Weight | 442.88 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-3-nitro-4-(1-pyridin-2-ylethylamino)benzamide |
| SMILES | CC(Nc1ccc(C(=O)N(C)Cc2c(F)cccc2Cl)cc1[N+](=O)[O-])c1ccccn1 |
| InChI | InChI=1S/C22H20ClFN4O3/c1-14(19-8-3-4-11-25-19)26-20-10-9-15(12-21(20)28(30)31)22(29)27(2)13-16-17(23)6-5-7-18(16)24/h3-12,14,26H,13H2,1-2H3 |
| InChIKey | YWUROKOHOWJYPN-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.88 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|