C21H17F2N5O4 — CID 56570331
2,4-difluoro-5-[[3-nitro-4-(1-pyridin-2-ylethylamino)benzoyl]amino]benzamide (PubChem CID 56570331) has the molecular formula C21H17F2N5O4 and a molecular weight of 441.39 g/mol. Its IUPAC name is 2,4-difluoro-5-[[3-nitro-4-(1-pyridin-2-ylethylamino)benzoyl]amino]benzamide.
| Compound Name | 2,4-difluoro-5-[[3-nitro-4-(1-pyridin-2-ylethylamino)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 56570331 |
| Molecular Formula | C21H17F2N5O4 |
| Molecular Weight | 441.39 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 2,4-difluoro-5-[[3-nitro-4-(1-pyridin-2-ylethylamino)benzoyl]amino]benzamide |
| SMILES | CC(Nc1ccc(C(=O)Nc2cc(C(N)=O)c(F)cc2F)cc1[N+](=O)[O-])c1ccccn1 |
| InChI | InChI=1S/C21H17F2N5O4/c1-11(16-4-2-3-7-25-16)26-17-6-5-12(8-19(17)28(31)32)21(30)27-18-9-13(20(24)29)14(22)10-15(18)23/h2-11,26H,1H3,(H2,24,29)(H,27,30) |
| InChIKey | VPOHWSYYFXIASC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 140.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|