C18H24N2O4S4 — CID 560430
diethyl 2,5-bis(dimethylcarbamothioylsulfanyl)benzene-1,4-dicarboxylate (PubChem CID 560430) has the molecular formula C18H24N2O4S4 and a molecular weight of 460.67 g/mol. Its IUPAC name is diethyl 2,5-bis(dimethylcarbamothioylsulfanyl)benzene-1,4-dicarboxylate.
| Compound Name | diethyl 2,5-bis(dimethylcarbamothioylsulfanyl)benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 560430 |
| Molecular Formula | C18H24N2O4S4 |
| Molecular Weight | 460.67 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | diethyl 2,5-bis(dimethylcarbamothioylsulfanyl)benzene-1,4-dicarboxylate |
| SMILES | CCOC(=O)c1cc(SC(=S)N(C)C)c(C(=O)OCC)cc1SC(=S)N(C)C |
| InChI | InChI=1S/C18H24N2O4S4/c1-7-23-15(21)11-9-14(28-18(26)20(5)6)12(16(22)24-8-2)10-13(11)27-17(25)19(3)4/h9-10H,7-8H2,1-6H3 |
| InChIKey | MWXFOGYUPXBTAH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.67 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|