About O-phenyl N-(dimethylcarbamothioyl)-N-(4-fluorophenyl)carbamothioate
O-phenyl N-(dimethylcarbamothioyl)-N-(4-fluorophenyl)carbamothioate (PubChem CID 560544) has the molecular formula C16H15FN2OS2
and a molecular weight of 334.44 g/mol. Its IUPAC name is O-phenyl N-(dimethylcarbamothioyl)-N-(4-fluorophenyl)carbamothioate.
Molecular Properties
| Compound Name | O-phenyl N-(dimethylcarbamothioyl)-N-(4-fluorophenyl)carbamothioate |
| PubChem CID | 560544 |
| Molecular Formula | C16H15FN2OS2 |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | O-phenyl N-(dimethylcarbamothioyl)-N-(4-fluorophenyl)carbamothioate |
| SMILES | CN(C)C(=S)N(C(=S)Oc1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H15FN2OS2/c1-18(2)15(21)19(13-10-8-12(17)9-11-13)16(22)20-14-6-4-3-5-7-14/h3-11H,1-2H3 |
| InChIKey | DVNMISIPPMNQBQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-phenyl N-(dimethylcarbamothioyl)-N-(4-fluorophenyl)carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-phenyl N-(dimethylcarbamothioyl)-N-(4-fluorophenyl)carbamothioate?
The IUPAC name of O-phenyl N-(dimethylcarbamothioyl)-N-(4-fluorophenyl)carbamothioate (CID 560544) is O-phenyl N-(dimethylcarbamothioyl)-N-(4-fluorophenyl)carbamothioate.
What is the SMILES notation for O-phenyl N-(dimethylcarbamothioyl)-N-(4-fluorophenyl)carbamothioate?
The canonical SMILES for O-phenyl N-(dimethylcarbamothioyl)-N-(4-fluorophenyl)carbamothioate is CN(C)C(=S)N(C(=S)Oc1ccccc1)c1ccc(F)cc1.
What is the InChIKey of O-phenyl N-(dimethylcarbamothioyl)-N-(4-fluorophenyl)carbamothioate?
The InChIKey is DVNMISIPPMNQBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15FN2OS2/c1-18(2)15(21)19(13-10-8-12(17)9-11-13)16(22)20-14-6-4-3-5-7-14/h3-11H,1-2H3.
What are the key properties of O-phenyl N-(dimethylcarbamothioyl)-N-(4-fluorophenyl)carbamothioate?
O-phenyl N-(dimethylcarbamothioyl)-N-(4-fluorophenyl)carbamothioate has a molecular weight of 334.44 g/mol, XLogP of 3.84, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-phenyl N-(dimethylcarbamothioyl)-N-(4-fluorophenyl)carbamothioate is sourced from PubChem (CID 560544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).