C25H36FNO2Si — CID 561603
6-[fluoro(dimethyl)silyl]-3-(10-phenyldecyl)-6,7-dihydro-5H-1,2-benzoxazol-4-one (PubChem CID 561603) has the molecular formula C25H36FNO2Si and a molecular weight of 429.65 g/mol. Its IUPAC name is 6-[fluoro(dimethyl)silyl]-3-(10-phenyldecyl)-6,7-dihydro-5H-1,2-benzoxazol-4-one.
| Compound Name | 6-[fluoro(dimethyl)silyl]-3-(10-phenyldecyl)-6,7-dihydro-5H-1,2-benzoxazol-4-one |
|---|---|
| PubChem CID | 561603 |
| Molecular Formula | C25H36FNO2Si |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | 6-[fluoro(dimethyl)silyl]-3-(10-phenyldecyl)-6,7-dihydro-5H-1,2-benzoxazol-4-one |
| SMILES | C[Si](C)(F)C1CC(=O)c2c(CCCCCCCCCCc3ccccc3)noc2C1 |
| InChI | InChI=1S/C25H36FNO2Si/c1-30(2,26)21-18-23(28)25-22(27-29-24(25)19-21)17-13-8-6-4-3-5-7-10-14-20-15-11-9-12-16-20/h9,11-12,15-16,21H,3-8,10,13-14,17-19H2,1-2H3 |
| InChIKey | KWHDETIMZYTSGX-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|