About 4-diazoadamantan-2-one
4-diazoadamantan-2-one (PubChem CID 561686) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 4-diazoadamantan-2-one.
Molecular Properties
| Compound Name | 4-diazoadamantan-2-one |
| PubChem CID | 561686 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 4-diazoadamantan-2-one |
| SMILES | [N-]=[N+]=C1C2CC3CC(C2)C(=O)C1C3 |
| InChI | InChI=1S/C10H12N2O/c11-12-9-6-1-5-2-7(4-6)10(13)8(9)3-5/h5-8H,1-4H2 |
| InChIKey | IJBCULQFUOINEX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-diazoadamantan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-diazoadamantan-2-one?
The IUPAC name of 4-diazoadamantan-2-one (CID 561686) is 4-diazoadamantan-2-one.
What is the SMILES notation for 4-diazoadamantan-2-one?
The canonical SMILES for 4-diazoadamantan-2-one is [N-]=[N+]=C1C2CC3CC(C2)C(=O)C1C3.
What is the InChIKey of 4-diazoadamantan-2-one?
The InChIKey is IJBCULQFUOINEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c11-12-9-6-1-5-2-7(4-6)10(13)8(9)3-5/h5-8H,1-4H2.
What are the key properties of 4-diazoadamantan-2-one?
4-diazoadamantan-2-one has a molecular weight of 176.22 g/mol, XLogP of 1.29, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-diazoadamantan-2-one is sourced from PubChem (CID 561686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).