C13H16O7S — CID 562828
[3-(1,2-dihydroxy-3-oxopropyl)oxiran-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 562828) has the molecular formula C13H16O7S and a molecular weight of 316.33 g/mol. Its IUPAC name is [3-(1,2-dihydroxy-3-oxopropyl)oxiran-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [3-(1,2-dihydroxy-3-oxopropyl)oxiran-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 562828 |
| Molecular Formula | C13H16O7S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | [3-(1,2-dihydroxy-3-oxopropyl)oxiran-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2OC2C(O)C(O)C=O)cc1 |
| InChI | InChI=1S/C13H16O7S/c1-8-2-4-9(5-3-8)21(17,18)19-7-11-13(20-11)12(16)10(15)6-14/h2-6,10-13,15-16H,7H2,1H3 |
| InChIKey | SHYFDYMLVVGKHO-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|