C18H14F3NO2S — CID 563498
benzyl 3-methyl-6-(trifluoromethyl)-4H-1,4-benzothiazine-2-carboxylate (PubChem CID 563498) has the molecular formula C18H14F3NO2S and a molecular weight of 365.38 g/mol. Its IUPAC name is benzyl 3-methyl-6-(trifluoromethyl)-4H-1,4-benzothiazine-2-carboxylate.
| Compound Name | benzyl 3-methyl-6-(trifluoromethyl)-4H-1,4-benzothiazine-2-carboxylate |
|---|---|
| PubChem CID | 563498 |
| Molecular Formula | C18H14F3NO2S |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | benzyl 3-methyl-6-(trifluoromethyl)-4H-1,4-benzothiazine-2-carboxylate |
| SMILES | CC1=C(C(=O)OCc2ccccc2)Sc2ccc(C(F)(F)F)cc2N1 |
| InChI | InChI=1S/C18H14F3NO2S/c1-11-16(17(23)24-10-12-5-3-2-4-6-12)25-15-8-7-13(18(19,20)21)9-14(15)22-11/h2-9,22H,10H2,1H3 |
| InChIKey | IPYHHPHWASIDHV-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|