C15H24O3 — CID 564361
4a-but-3-enyl-2-tert-butyl-5,6,7,7a-tetrahydrocyclopenta[d][1,3]dioxin-4-one (PubChem CID 564361) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 4a-but-3-enyl-2-tert-butyl-5,6,7,7a-tetrahydrocyclopenta[d][1,3]dioxin-4-one.
| Compound Name | 4a-but-3-enyl-2-tert-butyl-5,6,7,7a-tetrahydrocyclopenta[d][1,3]dioxin-4-one |
|---|---|
| PubChem CID | 564361 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 4a-but-3-enyl-2-tert-butyl-5,6,7,7a-tetrahydrocyclopenta[d][1,3]dioxin-4-one |
| SMILES | C=CCCC12CCCC1OC(C(C)(C)C)OC2=O |
| InChI | InChI=1S/C15H24O3/c1-5-6-9-15-10-7-8-11(15)17-13(14(2,3)4)18-12(15)16/h5,11,13H,1,6-10H2,2-4H3 |
| InChIKey | HLGXRERPZXFBNW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|