C20H29N5O2 — CID 56503498
1-tert-butyl-N'-[2-(4-methylanilino)acetyl]-5-propan-2-ylpyrazole-3-carbohydrazide (PubChem CID 56503498) has the molecular formula C20H29N5O2 and a molecular weight of 371.49 g/mol. Its IUPAC name is 1-tert-butyl-N'-[2-(4-methylanilino)acetyl]-5-propan-2-ylpyrazole-3-carbohydrazide.
| Compound Name | 1-tert-butyl-N'-[2-(4-methylanilino)acetyl]-5-propan-2-ylpyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 56503498 |
| Molecular Formula | C20H29N5O2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | 1-tert-butyl-N'-[2-(4-methylanilino)acetyl]-5-propan-2-ylpyrazole-3-carbohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)c2cc(C(C)C)n(C(C)(C)C)n2)cc1 |
| InChI | InChI=1S/C20H29N5O2/c1-13(2)17-11-16(24-25(17)20(4,5)6)19(27)23-22-18(26)12-21-15-9-7-14(3)8-10-15/h7-11,13,21H,12H2,1-6H3,(H,22,26)(H,23,27) |
| InChIKey | JBANTRLYDQFNJT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|