C19H20F3N3O3 — CID 56504019
2-(2,4-dimethylanilino)-N'-[2-[4-(trifluoromethyl)phenoxy]acetyl]acetohydrazide (PubChem CID 56504019) has the molecular formula C19H20F3N3O3 and a molecular weight of 395.38 g/mol. Its IUPAC name is 2-(2,4-dimethylanilino)-N'-[2-[4-(trifluoromethyl)phenoxy]acetyl]acetohydrazide.
| Compound Name | 2-(2,4-dimethylanilino)-N'-[2-[4-(trifluoromethyl)phenoxy]acetyl]acetohydrazide |
|---|---|
| PubChem CID | 56504019 |
| Molecular Formula | C19H20F3N3O3 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-(2,4-dimethylanilino)-N'-[2-[4-(trifluoromethyl)phenoxy]acetyl]acetohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)COc2ccc(C(F)(F)F)cc2)c(C)c1 |
| InChI | InChI=1S/C19H20F3N3O3/c1-12-3-8-16(13(2)9-12)23-10-17(26)24-25-18(27)11-28-15-6-4-14(5-7-15)19(20,21)22/h3-9,23H,10-11H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | HTDXNPDOYYYCHM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|