C22H22BrN3O4 — CID 56504146
5-[(4-bromophenoxy)methyl]-N'-[2-(2,4-dimethylanilino)acetyl]furan-2-carbohydrazide (PubChem CID 56504146) has the molecular formula C22H22BrN3O4 and a molecular weight of 472.34 g/mol. Its IUPAC name is 5-[(4-bromophenoxy)methyl]-N'-[2-(2,4-dimethylanilino)acetyl]furan-2-carbohydrazide.
| Compound Name | 5-[(4-bromophenoxy)methyl]-N'-[2-(2,4-dimethylanilino)acetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 56504146 |
| Molecular Formula | C22H22BrN3O4 |
| Molecular Weight | 472.34 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | 5-[(4-bromophenoxy)methyl]-N'-[2-(2,4-dimethylanilino)acetyl]furan-2-carbohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)c2ccc(COc3ccc(Br)cc3)o2)c(C)c1 |
| InChI | InChI=1S/C22H22BrN3O4/c1-14-3-9-19(15(2)11-14)24-12-21(27)25-26-22(28)20-10-8-18(30-20)13-29-17-6-4-16(23)5-7-17/h3-11,24H,12-13H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | NQTAZRWWPWDRIS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|