C27H35N5O2 — CID 56504511
N'-(2-cyanoethyl)-N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]-N'-phenylbutanediamide (PubChem CID 56504511) has the molecular formula C27H35N5O2 and a molecular weight of 461.61 g/mol. Its IUPAC name is N'-(2-cyanoethyl)-N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]-N'-phenylbutanediamide.
| Compound Name | N'-(2-cyanoethyl)-N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]-N'-phenylbutanediamide |
|---|---|
| PubChem CID | 56504511 |
| Molecular Formula | C27H35N5O2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | N'-(2-cyanoethyl)-N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]-N'-phenylbutanediamide |
| SMILES | Cc1cccc(N2CCN(CCCNC(=O)CCC(=O)N(CCC#N)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C27H35N5O2/c1-23-8-5-11-25(22-23)31-20-18-30(19-21-31)16-7-15-29-26(33)12-13-27(34)32(17-6-14-28)24-9-3-2-4-10-24/h2-5,8-11,22H,6-7,12-13,15-21H2,1H3,(H,29,33) |
| InChIKey | FDVNFCOZVRUEOK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 79.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|