C19H24ClNO2S2 — CID 56509369
3-(2-chlorophenyl)sulfanyl-N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]propan-1-amine (PubChem CID 56509369) has the molecular formula C19H24ClNO2S2 and a molecular weight of 397.99 g/mol. Its IUPAC name is 3-(2-chlorophenyl)sulfanyl-N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]propan-1-amine.
| Compound Name | 3-(2-chlorophenyl)sulfanyl-N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 56509369 |
| Molecular Formula | C19H24ClNO2S2 |
| Molecular Weight | 397.99 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 3-(2-chlorophenyl)sulfanyl-N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]propan-1-amine |
| SMILES | CC(c1ccc(S(C)(=O)=O)cc1)N(C)CCCSc1ccccc1Cl |
| InChI | InChI=1S/C19H24ClNO2S2/c1-15(16-9-11-17(12-10-16)25(3,22)23)21(2)13-6-14-24-19-8-5-4-7-18(19)20/h4-5,7-12,15H,6,13-14H2,1-3H3 |
| InChIKey | ZMKZDCNWMNWYDX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.99 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|