C25H24N4O4 — CID 56513537
N-[4-[(2-methylimidazol-1-yl)methyl]phenyl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide (PubChem CID 56513537) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is N-[4-[(2-methylimidazol-1-yl)methyl]phenyl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide.
| Compound Name | N-[4-[(2-methylimidazol-1-yl)methyl]phenyl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 56513537 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N-[4-[(2-methylimidazol-1-yl)methyl]phenyl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide |
| SMILES | Cc1nccn1Cc1ccc(NC(=O)c2ccc3c(c2)C(=O)N(CC2CCCO2)C3=O)cc1 |
| InChI | InChI=1S/C25H24N4O4/c1-16-26-10-11-28(16)14-17-4-7-19(8-5-17)27-23(30)18-6-9-21-22(13-18)25(32)29(24(21)31)15-20-3-2-12-33-20/h4-11,13,20H,2-3,12,14-15H2,1H3,(H,27,30) |
| InChIKey | RQESYCXIMZACDQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|