C18H16F3N3O — CID 56519892
1-ethyl-N'-[3-(trifluoromethyl)phenyl]indole-2-carbohydrazide (PubChem CID 56519892) has the molecular formula C18H16F3N3O and a molecular weight of 347.34 g/mol. Its IUPAC name is 1-ethyl-N'-[3-(trifluoromethyl)phenyl]indole-2-carbohydrazide.
| Compound Name | 1-ethyl-N'-[3-(trifluoromethyl)phenyl]indole-2-carbohydrazide |
|---|---|
| PubChem CID | 56519892 |
| Molecular Formula | C18H16F3N3O |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 1-ethyl-N'-[3-(trifluoromethyl)phenyl]indole-2-carbohydrazide |
| SMILES | CCn1c(C(=O)NNc2cccc(C(F)(F)F)c2)cc2ccccc21 |
| InChI | InChI=1S/C18H16F3N3O/c1-2-24-15-9-4-3-6-12(15)10-16(24)17(25)23-22-14-8-5-7-13(11-14)18(19,20)21/h3-11,22H,2H2,1H3,(H,23,25) |
| InChIKey | PEYKWXXWNMWKKX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|