C20H27ClN4O3 — CID 56525653
1-[3-(3-chloro-4-cyanoanilino)-3-oxopropyl]-N-(3-methoxypropyl)piperidine-4-carboxamide (PubChem CID 56525653) has the molecular formula C20H27ClN4O3 and a molecular weight of 406.91 g/mol. Its IUPAC name is 1-[3-(3-chloro-4-cyanoanilino)-3-oxopropyl]-N-(3-methoxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-[3-(3-chloro-4-cyanoanilino)-3-oxopropyl]-N-(3-methoxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 56525653 |
| Molecular Formula | C20H27ClN4O3 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 1-[3-(3-chloro-4-cyanoanilino)-3-oxopropyl]-N-(3-methoxypropyl)piperidine-4-carboxamide |
| SMILES | COCCCNC(=O)C1CCN(CCC(=O)Nc2ccc(C#N)c(Cl)c2)CC1 |
| InChI | InChI=1S/C20H27ClN4O3/c1-28-12-2-8-23-20(27)15-5-9-25(10-6-15)11-7-19(26)24-17-4-3-16(14-22)18(21)13-17/h3-4,13,15H,2,5-12H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | DUFWPJUHIDEEHG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|