C19H24ClN3O3 — CID 56526255
ethyl 3-[[3-(3-chloro-4-cyanoanilino)-3-oxopropyl]-(cyclopropylmethyl)amino]propanoate (PubChem CID 56526255) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is ethyl 3-[[3-(3-chloro-4-cyanoanilino)-3-oxopropyl]-(cyclopropylmethyl)amino]propanoate.
| Compound Name | ethyl 3-[[3-(3-chloro-4-cyanoanilino)-3-oxopropyl]-(cyclopropylmethyl)amino]propanoate |
|---|---|
| PubChem CID | 56526255 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | ethyl 3-[[3-(3-chloro-4-cyanoanilino)-3-oxopropyl]-(cyclopropylmethyl)amino]propanoate |
| SMILES | CCOC(=O)CCN(CCC(=O)Nc1ccc(C#N)c(Cl)c1)CC1CC1 |
| InChI | InChI=1S/C19H24ClN3O3/c1-2-26-19(25)8-10-23(13-14-3-4-14)9-7-18(24)22-16-6-5-15(12-21)17(20)11-16/h5-6,11,14H,2-4,7-10,13H2,1H3,(H,22,24) |
| InChIKey | PBJYTVIHGPMNJI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |