C18H23N7O4S — CID 56543879
4-(4-acetylpiperazin-1-yl)-N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-nitrobenzamide (PubChem CID 56543879) has the molecular formula C18H23N7O4S and a molecular weight of 433.49 g/mol. Its IUPAC name is 4-(4-acetylpiperazin-1-yl)-N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-nitrobenzamide.
| Compound Name | 4-(4-acetylpiperazin-1-yl)-N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 56543879 |
| Molecular Formula | C18H23N7O4S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 4-(4-acetylpiperazin-1-yl)-N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-nitrobenzamide |
| SMILES | CCn1c(CNC(=O)c2ccc(N3CCN(C(C)=O)CC3)c([N+](=O)[O-])c2)n[nH]c1=S |
| InChI | InChI=1S/C18H23N7O4S/c1-3-24-16(20-21-18(24)30)11-19-17(27)13-4-5-14(15(10-13)25(28)29)23-8-6-22(7-9-23)12(2)26/h4-5,10H,3,6-9,11H2,1-2H3,(H,19,27)(H,21,30) |
| InChIKey | FURLVRGBZHLJMV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 129.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|