C24H22N2O5 — CID 56545443
4-[4-[1,3-benzodioxol-5-ylmethyl(ethyl)carbamoyl]phenoxy]benzamide (PubChem CID 56545443) has the molecular formula C24H22N2O5 and a molecular weight of 418.45 g/mol. Its IUPAC name is 4-[4-[1,3-benzodioxol-5-ylmethyl(ethyl)carbamoyl]phenoxy]benzamide.
| Compound Name | 4-[4-[1,3-benzodioxol-5-ylmethyl(ethyl)carbamoyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 56545443 |
| Molecular Formula | C24H22N2O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 4-[4-[1,3-benzodioxol-5-ylmethyl(ethyl)carbamoyl]phenoxy]benzamide |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)C(=O)c1ccc(Oc2ccc(C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C24H22N2O5/c1-2-26(14-16-3-12-21-22(13-16)30-15-29-21)24(28)18-6-10-20(11-7-18)31-19-8-4-17(5-9-19)23(25)27/h3-13H,2,14-15H2,1H3,(H2,25,27) |
| InChIKey | JJRJXEPDZYXHSW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |