C21H30N4O4 — CID 56546213
N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N',N'-dipropylpentanediamide (PubChem CID 56546213) has the molecular formula C21H30N4O4 and a molecular weight of 402.50 g/mol. Its IUPAC name is N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N',N'-dipropylpentanediamide.
| Compound Name | N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N',N'-dipropylpentanediamide |
|---|---|
| PubChem CID | 56546213 |
| Molecular Formula | C21H30N4O4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N',N'-dipropylpentanediamide |
| SMILES | CCCN(CCC)C(=O)CCCC(=O)NN1C(=O)NC(C)(c2ccccc2)C1=O |
| InChI | InChI=1S/C21H30N4O4/c1-4-14-24(15-5-2)18(27)13-9-12-17(26)23-25-19(28)21(3,22-20(25)29)16-10-7-6-8-11-16/h6-8,10-11H,4-5,9,12-15H2,1-3H3,(H,22,29)(H,23,26) |
| InChIKey | GZRLYLJXTXXAHC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|