C23H22ClN5O — CID 56547157
1-(4-chlorophenyl)-2,5-dimethyl-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyrrole-3-carboxamide (PubChem CID 56547157) has the molecular formula C23H22ClN5O and a molecular weight of 419.92 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,5-dimethyl-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyrrole-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-2,5-dimethyl-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 56547157 |
| Molecular Formula | C23H22ClN5O |
| Molecular Weight | 419.92 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 1-(4-chlorophenyl)-2,5-dimethyl-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC(Cn2cncn2)c2ccccc2)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H22ClN5O/c1-16-12-21(17(2)29(16)20-10-8-19(24)9-11-20)23(30)27-22(13-28-15-25-14-26-28)18-6-4-3-5-7-18/h3-12,14-15,22H,13H2,1-2H3,(H,27,30) |
| InChIKey | MOWCDIXKRBAIGK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.92 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|