C20H20FN5O3S — CID 56547602
4-fluoro-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]-3-(prop-2-enylsulfamoyl)benzamide (PubChem CID 56547602) has the molecular formula C20H20FN5O3S and a molecular weight of 429.48 g/mol. Its IUPAC name is 4-fluoro-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]-3-(prop-2-enylsulfamoyl)benzamide.
| Compound Name | 4-fluoro-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]-3-(prop-2-enylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 56547602 |
| Molecular Formula | C20H20FN5O3S |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 4-fluoro-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]-3-(prop-2-enylsulfamoyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1cc(C(=O)NC(Cn2cncn2)c2ccccc2)ccc1F |
| InChI | InChI=1S/C20H20FN5O3S/c1-2-10-24-30(28,29)19-11-16(8-9-17(19)21)20(27)25-18(12-26-14-22-13-23-26)15-6-4-3-5-7-15/h2-9,11,13-14,18,24H,1,10,12H2,(H,25,27) |
| InChIKey | AXBGMHAVHJNYDB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|