C19H18ClN5O2 — CID 97070868
N-(3-chloro-4-methylphenyl)-N'-[(1R)-1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]oxamide (PubChem CID 97070868) has the molecular formula C19H18ClN5O2 and a molecular weight of 383.84 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-N'-[(1R)-1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]oxamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-N'-[(1R)-1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 97070868 |
| Molecular Formula | C19H18ClN5O2 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-N'-[(1R)-1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)N[C@@H](Cn2cncn2)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C19H18ClN5O2/c1-13-7-8-15(9-16(13)20)23-18(26)19(27)24-17(10-25-12-21-11-22-25)14-5-3-2-4-6-14/h2-9,11-12,17H,10H2,1H3,(H,23,26)(H,24,27)/t17-/m0/s1 |
| InChIKey | LISXNOKAZBIIMJ-KRWDZBQOSA-N |
| XLogP | 2.74 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|