C21H18N6O2 — CID 71907555
N'-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]-N-quinolin-8-yloxamide (PubChem CID 71907555) has the molecular formula C21H18N6O2 and a molecular weight of 386.42 g/mol. Its IUPAC name is N'-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]-N-quinolin-8-yloxamide.
| Compound Name | N'-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]-N-quinolin-8-yloxamide |
|---|---|
| PubChem CID | 71907555 |
| Molecular Formula | C21H18N6O2 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N'-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]-N-quinolin-8-yloxamide |
| SMILES | O=C(Nc1cccc2cccnc12)C(=O)NC(Cn1cncn1)c1ccccc1 |
| InChI | InChI=1S/C21H18N6O2/c28-20(25-17-10-4-8-16-9-5-11-23-19(16)17)21(29)26-18(12-27-14-22-13-24-27)15-6-2-1-3-7-15/h1-11,13-14,18H,12H2,(H,25,28)(H,26,29) |
| InChIKey | MKSNJMOKNUJJBG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|