C20H17FN4O — CID 56553608
4-(4-fluorophenoxy)-N-[2-(1H-indol-3-yl)ethyl]pyrimidin-2-amine (PubChem CID 56553608) has the molecular formula C20H17FN4O and a molecular weight of 348.38 g/mol. Its IUPAC name is 4-(4-fluorophenoxy)-N-[2-(1H-indol-3-yl)ethyl]pyrimidin-2-amine.
| Compound Name | 4-(4-fluorophenoxy)-N-[2-(1H-indol-3-yl)ethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 56553608 |
| Molecular Formula | C20H17FN4O |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 4-(4-fluorophenoxy)-N-[2-(1H-indol-3-yl)ethyl]pyrimidin-2-amine |
| SMILES | Fc1ccc(Oc2ccnc(NCCc3c[nH]c4ccccc34)n2)cc1 |
| InChI | InChI=1S/C20H17FN4O/c21-15-5-7-16(8-6-15)26-19-10-12-23-20(25-19)22-11-9-14-13-24-18-4-2-1-3-17(14)18/h1-8,10,12-13,24H,9,11H2,(H,22,23,25) |
| InChIKey | JVKKDZUPKPMBGI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |