C21H21FN4O2S — CID 56554358
1-[2-(2-fluorophenoxy)ethyl]-1-methyl-3-(2-methyl-4-pyrimidin-2-ylsulfanylphenyl)urea (PubChem CID 56554358) has the molecular formula C21H21FN4O2S and a molecular weight of 412.49 g/mol. Its IUPAC name is 1-[2-(2-fluorophenoxy)ethyl]-1-methyl-3-(2-methyl-4-pyrimidin-2-ylsulfanylphenyl)urea.
| Compound Name | 1-[2-(2-fluorophenoxy)ethyl]-1-methyl-3-(2-methyl-4-pyrimidin-2-ylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 56554358 |
| Molecular Formula | C21H21FN4O2S |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 1-[2-(2-fluorophenoxy)ethyl]-1-methyl-3-(2-methyl-4-pyrimidin-2-ylsulfanylphenyl)urea |
| SMILES | Cc1cc(Sc2ncccn2)ccc1NC(=O)N(C)CCOc1ccccc1F |
| InChI | InChI=1S/C21H21FN4O2S/c1-15-14-16(29-20-23-10-5-11-24-20)8-9-18(15)25-21(27)26(2)12-13-28-19-7-4-3-6-17(19)22/h3-11,14H,12-13H2,1-2H3,(H,25,27) |
| InChIKey | BLRGPHJZBRRYJR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |