C20H14FN3O5S — CID 56561894
N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-1,3-dioxoisoindole-5-sulfonamide (PubChem CID 56561894) has the molecular formula C20H14FN3O5S and a molecular weight of 427.41 g/mol. Its IUPAC name is N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-1,3-dioxoisoindole-5-sulfonamide.
| Compound Name | N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-1,3-dioxoisoindole-5-sulfonamide |
|---|---|
| PubChem CID | 56561894 |
| Molecular Formula | C20H14FN3O5S |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-1,3-dioxoisoindole-5-sulfonamide |
| SMILES | O=C1NC(=O)c2cc(S(=O)(=O)NCc3cccnc3Oc3cccc(F)c3)ccc21 |
| InChI | InChI=1S/C20H14FN3O5S/c21-13-4-1-5-14(9-13)29-20-12(3-2-8-22-20)11-23-30(27,28)15-6-7-16-17(10-15)19(26)24-18(16)25/h1-10,23H,11H2,(H,24,25,26) |
| InChIKey | OOMOJFVFHONRMI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|