C18H21Cl2NO4S — CID 56567769
methyl 2-[3-[4-(3,4-dichlorobenzoyl)piperidin-1-yl]-3-oxopropyl]sulfanylacetate (PubChem CID 56567769) has the molecular formula C18H21Cl2NO4S and a molecular weight of 418.34 g/mol. Its IUPAC name is methyl 2-[3-[4-(3,4-dichlorobenzoyl)piperidin-1-yl]-3-oxopropyl]sulfanylacetate.
| Compound Name | methyl 2-[3-[4-(3,4-dichlorobenzoyl)piperidin-1-yl]-3-oxopropyl]sulfanylacetate |
|---|---|
| PubChem CID | 56567769 |
| Molecular Formula | C18H21Cl2NO4S |
| Molecular Weight | 418.34 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | methyl 2-[3-[4-(3,4-dichlorobenzoyl)piperidin-1-yl]-3-oxopropyl]sulfanylacetate |
| SMILES | COC(=O)CSCCC(=O)N1CCC(C(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C18H21Cl2NO4S/c1-25-17(23)11-26-9-6-16(22)21-7-4-12(5-8-21)18(24)13-2-3-14(19)15(20)10-13/h2-3,10,12H,4-9,11H2,1H3 |
| InChIKey | SBZGXKQGKAEXJG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|