C21H28Cl2N2O3 — CID 56520872
5-[4-(3,4-dichlorobenzoyl)piperidin-1-yl]-N,N-diethyl-5-oxopentanamide (PubChem CID 56520872) has the molecular formula C21H28Cl2N2O3 and a molecular weight of 427.37 g/mol. Its IUPAC name is 5-[4-(3,4-dichlorobenzoyl)piperidin-1-yl]-N,N-diethyl-5-oxopentanamide.
| Compound Name | 5-[4-(3,4-dichlorobenzoyl)piperidin-1-yl]-N,N-diethyl-5-oxopentanamide |
|---|---|
| PubChem CID | 56520872 |
| Molecular Formula | C21H28Cl2N2O3 |
| Molecular Weight | 427.37 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 5-[4-(3,4-dichlorobenzoyl)piperidin-1-yl]-N,N-diethyl-5-oxopentanamide |
| SMILES | CCN(CC)C(=O)CCCC(=O)N1CCC(C(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C21H28Cl2N2O3/c1-3-24(4-2)19(26)6-5-7-20(27)25-12-10-15(11-13-25)21(28)16-8-9-17(22)18(23)14-16/h8-9,14-15H,3-7,10-13H2,1-2H3 |
| InChIKey | GQHVQFCLECEYHP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |