C13H13IN4O3 — CID 56571459
4-[[2-(4-iodophenoxy)acetyl]amino]-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 56571459) has the molecular formula C13H13IN4O3 and a molecular weight of 400.18 g/mol. Its IUPAC name is 4-[[2-(4-iodophenoxy)acetyl]amino]-5-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | 4-[[2-(4-iodophenoxy)acetyl]amino]-5-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 56571459 |
| Molecular Formula | C13H13IN4O3 |
| Molecular Weight | 400.18 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | 4-[[2-(4-iodophenoxy)acetyl]amino]-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(N)=O)c1NC(=O)COc1ccc(I)cc1 |
| InChI | InChI=1S/C13H13IN4O3/c1-7-11(12(13(15)20)18-17-7)16-10(19)6-21-9-4-2-8(14)3-5-9/h2-5H,6H2,1H3,(H2,15,20)(H,16,19)(H,17,18) |
| InChIKey | HVZVWCQPSHOVLH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.18 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|