C18H18BrN3O3S — CID 56574617
5-bromo-N'-[2-(2-oxopiperidin-1-yl)-2-phenylacetyl]thiophene-2-carbohydrazide (PubChem CID 56574617) has the molecular formula C18H18BrN3O3S and a molecular weight of 436.33 g/mol. Its IUPAC name is 5-bromo-N'-[2-(2-oxopiperidin-1-yl)-2-phenylacetyl]thiophene-2-carbohydrazide.
| Compound Name | 5-bromo-N'-[2-(2-oxopiperidin-1-yl)-2-phenylacetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 56574617 |
| Molecular Formula | C18H18BrN3O3S |
| Molecular Weight | 436.33 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | 5-bromo-N'-[2-(2-oxopiperidin-1-yl)-2-phenylacetyl]thiophene-2-carbohydrazide |
| SMILES | O=C(NNC(=O)C(c1ccccc1)N1CCCCC1=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C18H18BrN3O3S/c19-14-10-9-13(26-14)17(24)20-21-18(25)16(12-6-2-1-3-7-12)22-11-5-4-8-15(22)23/h1-3,6-7,9-10,16H,4-5,8,11H2,(H,20,24)(H,21,25) |
| InChIKey | CJWNBVOHEBOBFB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|