C19H24FN5O2S — CID 56578319
N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-1-(4-fluorobenzoyl)piperidine-3-carboxamide (PubChem CID 56578319) has the molecular formula C19H24FN5O2S and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-1-(4-fluorobenzoyl)piperidine-3-carboxamide.
| Compound Name | N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-1-(4-fluorobenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56578319 |
| Molecular Formula | C19H24FN5O2S |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-1-(4-fluorobenzoyl)piperidine-3-carboxamide |
| SMILES | CCn1c(CCNC(=O)C2CCCN(C(=O)c3ccc(F)cc3)C2)n[nH]c1=S |
| InChI | InChI=1S/C19H24FN5O2S/c1-2-25-16(22-23-19(25)28)9-10-21-17(26)14-4-3-11-24(12-14)18(27)13-5-7-15(20)8-6-13/h5-8,14H,2-4,9-12H2,1H3,(H,21,26)(H,23,28) |
| InChIKey | IHFJPBUOARAMQB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|