C24H17N5O2S — CID 56580014
N-[2-[[6-(benzimidazol-1-yl)-3-pyridinyl]carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 56580014) has the molecular formula C24H17N5O2S and a molecular weight of 439.50 g/mol. Its IUPAC name is N-[2-[[6-(benzimidazol-1-yl)-3-pyridinyl]carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[6-(benzimidazol-1-yl)-3-pyridinyl]carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 56580014 |
| Molecular Formula | C24H17N5O2S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | N-[2-[[6-(benzimidazol-1-yl)-3-pyridinyl]carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1C(=O)Nc1ccc(-n2cnc3ccccc32)nc1)c1cccs1 |
| InChI | InChI=1S/C24H17N5O2S/c30-23(17-6-1-2-7-18(17)28-24(31)21-10-5-13-32-21)27-16-11-12-22(25-14-16)29-15-26-19-8-3-4-9-20(19)29/h1-15H,(H,27,30)(H,28,31) |
| InChIKey | VDCFRVLOZWXNMN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |