C21H19N5O4S2 — CID 55581961
N-[6-(benzimidazol-1-yl)-3-pyridinyl]-3-morpholin-4-ylsulfonylthiophene-2-carboxamide (PubChem CID 55581961) has the molecular formula C21H19N5O4S2 and a molecular weight of 469.55 g/mol. Its IUPAC name is N-[6-(benzimidazol-1-yl)-3-pyridinyl]-3-morpholin-4-ylsulfonylthiophene-2-carboxamide.
| Compound Name | N-[6-(benzimidazol-1-yl)-3-pyridinyl]-3-morpholin-4-ylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 55581961 |
| Molecular Formula | C21H19N5O4S2 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | N-[6-(benzimidazol-1-yl)-3-pyridinyl]-3-morpholin-4-ylsulfonylthiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(-n2cnc3ccccc32)nc1)c1sccc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H19N5O4S2/c27-21(20-18(7-12-31-20)32(28,29)25-8-10-30-11-9-25)24-15-5-6-19(22-13-15)26-14-23-16-3-1-2-4-17(16)26/h1-7,12-14H,8-11H2,(H,24,27) |
| InChIKey | HTPNCURMLFXRBB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |