C19H14N4O6S — CID 56582601
N-[4-[(1,3-dioxoisoindol-5-yl)sulfonylamino]phenyl]-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 56582601) has the molecular formula C19H14N4O6S and a molecular weight of 426.41 g/mol. Its IUPAC name is N-[4-[(1,3-dioxoisoindol-5-yl)sulfonylamino]phenyl]-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[4-[(1,3-dioxoisoindol-5-yl)sulfonylamino]phenyl]-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 56582601 |
| Molecular Formula | C19H14N4O6S |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | N-[4-[(1,3-dioxoisoindol-5-yl)sulfonylamino]phenyl]-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1oncc1C(=O)Nc1ccc(NS(=O)(=O)c2ccc3c(c2)C(=O)NC3=O)cc1 |
| InChI | InChI=1S/C19H14N4O6S/c1-10-16(9-20-29-10)19(26)21-11-2-4-12(5-3-11)23-30(27,28)13-6-7-14-15(8-13)18(25)22-17(14)24/h2-9,23H,1H3,(H,21,26)(H,22,24,25) |
| InChIKey | HIFSVWDOXKDXTG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 147.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|