C24H36N6O — CID 56585139
N-[3-(diethylamino)propyl]-1-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)piperidine-4-carboxamide (PubChem CID 56585139) has the molecular formula C24H36N6O and a molecular weight of 424.59 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-1-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)piperidine-4-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-1-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 56585139 |
| Molecular Formula | C24H36N6O |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | N-[3-(diethylamino)propyl]-1-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)piperidine-4-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)C1CCN(c2nc(-c3ccccn3)nc(C)c2C)CC1 |
| InChI | InChI=1S/C24H36N6O/c1-5-29(6-2)15-9-14-26-24(31)20-11-16-30(17-12-20)23-18(3)19(4)27-22(28-23)21-10-7-8-13-25-21/h7-8,10,13,20H,5-6,9,11-12,14-17H2,1-4H3,(H,26,31) |
| InChIKey | TXSAPTRBNMXRCO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|