C24H44O7Si — CID 56590302
methyl (3R)-4-[(2S,4S,6S)-4-acetyloxy-6-methoxy-5,5-dimethyl-6-prop-2-enyloxan-2-yl]-3-[tert-butyl(dimethyl)silyl]oxybutanoate (PubChem CID 56590302) has the molecular formula C24H44O7Si and a molecular weight of 472.70 g/mol. Its IUPAC name is methyl (3R)-4-[(2S,4S,6S)-4-acetyloxy-6-methoxy-5,5-dimethyl-6-prop-2-enyloxan-2-yl]-3-[tert-butyl(dimethyl)silyl]oxybutanoate.
| Compound Name | methyl (3R)-4-[(2S,4S,6S)-4-acetyloxy-6-methoxy-5,5-dimethyl-6-prop-2-enyloxan-2-yl]-3-[tert-butyl(dimethyl)silyl]oxybutanoate |
|---|---|
| PubChem CID | 56590302 |
| Molecular Formula | C24H44O7Si |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | methyl (3R)-4-[(2S,4S,6S)-4-acetyloxy-6-methoxy-5,5-dimethyl-6-prop-2-enyloxan-2-yl]-3-[tert-butyl(dimethyl)silyl]oxybutanoate |
| SMILES | C=CC[C@]1(OC)O[C@H](C[C@H](CC(=O)OC)O[Si](C)(C)C(C)(C)C)C[C@H](OC(C)=O)C1(C)C |
| InChI | InChI=1S/C24H44O7Si/c1-12-13-24(28-9)23(6,7)20(29-17(2)25)15-18(30-24)14-19(16-21(26)27-8)31-32(10,11)22(3,4)5/h12,18-20H,1,13-16H2,2-11H3/t18-,19-,20+,24+/m1/s1 |
| InChIKey | VIMFNWZFCYKJIN-FDGPYGQJSA-N |
| XLogP | 5.00 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|