C27H25F3N2O2 — CID 56593308
2-(cyclohexanecarbonylamino)-N-[3-[2-(trifluoromethyl)phenyl]phenyl]benzamide (PubChem CID 56593308) has the molecular formula C27H25F3N2O2 and a molecular weight of 466.50 g/mol. Its IUPAC name is 2-(cyclohexanecarbonylamino)-N-[3-[2-(trifluoromethyl)phenyl]phenyl]benzamide.
| Compound Name | 2-(cyclohexanecarbonylamino)-N-[3-[2-(trifluoromethyl)phenyl]phenyl]benzamide |
|---|---|
| PubChem CID | 56593308 |
| Molecular Formula | C27H25F3N2O2 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 2-(cyclohexanecarbonylamino)-N-[3-[2-(trifluoromethyl)phenyl]phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2ccccc2C(F)(F)F)c1)c1ccccc1NC(=O)C1CCCCC1 |
| InChI | InChI=1S/C27H25F3N2O2/c28-27(29,30)23-15-6-4-13-21(23)19-11-8-12-20(17-19)31-26(34)22-14-5-7-16-24(22)32-25(33)18-9-2-1-3-10-18/h4-8,11-18H,1-3,9-10H2,(H,31,34)(H,32,33) |
| InChIKey | VNXLCRZLATUWJC-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |