C15H25NO — CID 56593751
2-[(1S,2S,3R)-3-hydroxy-1,2-dimethyl-2-(4-methylpent-4-enyl)cyclopentyl]acetonitrile (PubChem CID 56593751) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 2-[(1S,2S,3R)-3-hydroxy-1,2-dimethyl-2-(4-methylpent-4-enyl)cyclopentyl]acetonitrile.
| Compound Name | 2-[(1S,2S,3R)-3-hydroxy-1,2-dimethyl-2-(4-methylpent-4-enyl)cyclopentyl]acetonitrile |
|---|---|
| PubChem CID | 56593751 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 2-[(1S,2S,3R)-3-hydroxy-1,2-dimethyl-2-(4-methylpent-4-enyl)cyclopentyl]acetonitrile |
| SMILES | C=C(C)CCC[C@]1(C)[C@H](O)CC[C@@]1(C)CC#N |
| InChI | InChI=1S/C15H25NO/c1-12(2)6-5-8-15(4)13(17)7-9-14(15,3)10-11-16/h13,17H,1,5-10H2,2-4H3/t13-,14+,15-/m1/s1 |
| InChIKey | JHDKUCSSCSXXSW-QLFBSQMISA-N |
| XLogP | 3.81 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|