C18H19ClN4O — CID 56594659
9-chloro-1-(cyclohexylamino)-5H-pyrido[4,3-b]indole-4-carboxamide (PubChem CID 56594659) has the molecular formula C18H19ClN4O and a molecular weight of 342.83 g/mol. Its IUPAC name is 9-chloro-1-(cyclohexylamino)-5H-pyrido[4,3-b]indole-4-carboxamide.
| Compound Name | 9-chloro-1-(cyclohexylamino)-5H-pyrido[4,3-b]indole-4-carboxamide |
|---|---|
| PubChem CID | 56594659 |
| Molecular Formula | C18H19ClN4O |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 9-chloro-1-(cyclohexylamino)-5H-pyrido[4,3-b]indole-4-carboxamide |
| SMILES | NC(=O)c1cnc(NC2CCCCC2)c2c1[nH]c1cccc(Cl)c12 |
| InChI | InChI=1S/C18H19ClN4O/c19-12-7-4-8-13-14(12)15-16(23-13)11(17(20)24)9-21-18(15)22-10-5-2-1-3-6-10/h4,7-10,23H,1-3,5-6H2,(H2,20,24)(H,21,22) |
| InChIKey | VYMXTTQKWUVBCN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |