C19H15N3O — CID 56594976
3-methyl-5-oxido-1,6-diphenylpyrazolo[4,3-c]pyridin-5-ium (PubChem CID 56594976) has the molecular formula C19H15N3O and a molecular weight of 301.35 g/mol. Its IUPAC name is 3-methyl-5-oxido-1,6-diphenylpyrazolo[4,3-c]pyridin-5-ium.
| Compound Name | 3-methyl-5-oxido-1,6-diphenylpyrazolo[4,3-c]pyridin-5-ium |
|---|---|
| PubChem CID | 56594976 |
| Molecular Formula | C19H15N3O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 3-methyl-5-oxido-1,6-diphenylpyrazolo[4,3-c]pyridin-5-ium |
| SMILES | Cc1nn(-c2ccccc2)c2cc(-c3ccccc3)[n+]([O-])cc12 |
| InChI | InChI=1S/C19H15N3O/c1-14-17-13-21(23)18(15-8-4-2-5-9-15)12-19(17)22(20-14)16-10-6-3-7-11-16/h2-13H,1H3 |
| InChIKey | ONXAEUNGXMZHNS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|