C10H10Cl2F3N — CID 56602011
3-chloro-N-[(4-chlorophenyl)methyl]-1,1,1-trifluoropropan-2-amine (PubChem CID 56602011) has the molecular formula C10H10Cl2F3N and a molecular weight of 272.10 g/mol. Its IUPAC name is 3-chloro-N-[(4-chlorophenyl)methyl]-1,1,1-trifluoropropan-2-amine.
| Compound Name | 3-chloro-N-[(4-chlorophenyl)methyl]-1,1,1-trifluoropropan-2-amine |
|---|---|
| PubChem CID | 56602011 |
| Molecular Formula | C10H10Cl2F3N |
| Molecular Weight | 272.10 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | 3-chloro-N-[(4-chlorophenyl)methyl]-1,1,1-trifluoropropan-2-amine |
| SMILES | FC(F)(F)C(CCl)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H10Cl2F3N/c11-5-9(10(13,14)15)16-6-7-1-3-8(12)4-2-7/h1-4,9,16H,5-6H2 |
| InChIKey | GFBBFULSLRPFAZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.10 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|