C27H35N3O5S — CID 56606901
3-[[2-methyl-3-(pyridin-2-ylcarbamoyl)-1,2-benzothiazin-4-yl]oxy]propyl octyl carbonate (PubChem CID 56606901) has the molecular formula C27H35N3O5S and a molecular weight of 513.66 g/mol. Its IUPAC name is 3-[[2-methyl-3-(pyridin-2-ylcarbamoyl)-1,2-benzothiazin-4-yl]oxy]propyl octyl carbonate.
| Compound Name | 3-[[2-methyl-3-(pyridin-2-ylcarbamoyl)-1,2-benzothiazin-4-yl]oxy]propyl octyl carbonate |
|---|---|
| PubChem CID | 56606901 |
| Molecular Formula | C27H35N3O5S |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 3-[[2-methyl-3-(pyridin-2-ylcarbamoyl)-1,2-benzothiazin-4-yl]oxy]propyl octyl carbonate |
| SMILES | CCCCCCCCOC(=O)OCCCOC1=C(C(=O)Nc2ccccn2)N(C)Sc2ccccc21 |
| InChI | InChI=1S/C27H35N3O5S/c1-3-4-5-6-7-12-18-34-27(32)35-20-13-19-33-25-21-14-8-9-15-22(21)36-30(2)24(25)26(31)29-23-16-10-11-17-28-23/h8-11,14-17H,3-7,12-13,18-20H2,1-2H3,(H,28,29,31) |
| InChIKey | NWIIFUKLQODCHM-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|