C23H31N3O5S2 — CID 70411338
4-hydroxy-2-methyl-N-[5-(nonylsulfonylmethyl)-1,2-oxazol-3-yl]-1,2-benzothiazine-3-carboxamide (PubChem CID 70411338) has the molecular formula C23H31N3O5S2 and a molecular weight of 493.65 g/mol. Its IUPAC name is 4-hydroxy-2-methyl-N-[5-(nonylsulfonylmethyl)-1,2-oxazol-3-yl]-1,2-benzothiazine-3-carboxamide.
| Compound Name | 4-hydroxy-2-methyl-N-[5-(nonylsulfonylmethyl)-1,2-oxazol-3-yl]-1,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 70411338 |
| Molecular Formula | C23H31N3O5S2 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | 4-hydroxy-2-methyl-N-[5-(nonylsulfonylmethyl)-1,2-oxazol-3-yl]-1,2-benzothiazine-3-carboxamide |
| SMILES | CCCCCCCCCS(=O)(=O)Cc1cc(NC(=O)C2=C(O)c3ccccc3SN2C)no1 |
| InChI | InChI=1S/C23H31N3O5S2/c1-3-4-5-6-7-8-11-14-33(29,30)16-17-15-20(25-31-17)24-23(28)21-22(27)18-12-9-10-13-19(18)32-26(21)2/h9-10,12-13,15,27H,3-8,11,14,16H2,1-2H3,(H,24,25,28) |
| InChIKey | KSEDBKDJFKQQPE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|