C22H29N3O3S2 — CID 70410277
4-hydroxy-2-methyl-N-[5-(octylsulfanylmethyl)-1,2-oxazol-3-yl]-1,2-benzothiazine-3-carboxamide (PubChem CID 70410277) has the molecular formula C22H29N3O3S2 and a molecular weight of 447.63 g/mol. Its IUPAC name is 4-hydroxy-2-methyl-N-[5-(octylsulfanylmethyl)-1,2-oxazol-3-yl]-1,2-benzothiazine-3-carboxamide.
| Compound Name | 4-hydroxy-2-methyl-N-[5-(octylsulfanylmethyl)-1,2-oxazol-3-yl]-1,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 70410277 |
| Molecular Formula | C22H29N3O3S2 |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 4-hydroxy-2-methyl-N-[5-(octylsulfanylmethyl)-1,2-oxazol-3-yl]-1,2-benzothiazine-3-carboxamide |
| SMILES | CCCCCCCCSCc1cc(NC(=O)C2=C(O)c3ccccc3SN2C)no1 |
| InChI | InChI=1S/C22H29N3O3S2/c1-3-4-5-6-7-10-13-29-15-16-14-19(24-28-16)23-22(27)20-21(26)17-11-8-9-12-18(17)30-25(20)2/h8-9,11-12,14,26H,3-7,10,13,15H2,1-2H3,(H,23,24,27) |
| InChIKey | ZCAOYDBYCFBCNX-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 78.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|