C17H17N3O2S — CID 56990367
4-(2-hydroxyethyl)-2-methyl-N-pyridin-2-yl-1,2-benzothiazine-3-carboxamide (PubChem CID 56990367) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is 4-(2-hydroxyethyl)-2-methyl-N-pyridin-2-yl-1,2-benzothiazine-3-carboxamide.
| Compound Name | 4-(2-hydroxyethyl)-2-methyl-N-pyridin-2-yl-1,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 56990367 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 4-(2-hydroxyethyl)-2-methyl-N-pyridin-2-yl-1,2-benzothiazine-3-carboxamide |
| SMILES | CN1Sc2ccccc2C(CCO)=C1C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C17H17N3O2S/c1-20-16(17(22)19-15-8-4-5-10-18-15)13(9-11-21)12-6-2-3-7-14(12)23-20/h2-8,10,21H,9,11H2,1H3,(H,18,19,22) |
| InChIKey | YJSMGWAXLZLVLK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|