C21H23N3O5S — CID 56634731
ethyl 3-[[2-methyl-3-(pyridin-2-ylcarbamoyl)-1,2-benzothiazin-4-yl]oxy]propyl carbonate (PubChem CID 56634731) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is ethyl 3-[[2-methyl-3-(pyridin-2-ylcarbamoyl)-1,2-benzothiazin-4-yl]oxy]propyl carbonate.
| Compound Name | ethyl 3-[[2-methyl-3-(pyridin-2-ylcarbamoyl)-1,2-benzothiazin-4-yl]oxy]propyl carbonate |
|---|---|
| PubChem CID | 56634731 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | ethyl 3-[[2-methyl-3-(pyridin-2-ylcarbamoyl)-1,2-benzothiazin-4-yl]oxy]propyl carbonate |
| SMILES | CCOC(=O)OCCCOC1=C(C(=O)Nc2ccccn2)N(C)Sc2ccccc21 |
| InChI | InChI=1S/C21H23N3O5S/c1-3-27-21(26)29-14-8-13-28-19-15-9-4-5-10-16(15)30-24(2)18(19)20(25)23-17-11-6-7-12-22-17/h4-7,9-12H,3,8,13-14H2,1-2H3,(H,22,23,25) |
| InChIKey | LNNJWNVTKWRVEF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|