C24H33N3O6S2 — CID 70411262
N-[5-(decylsulfinylmethyl)-1,2-oxazol-3-yl]-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide (PubChem CID 70411262) has the molecular formula C24H33N3O6S2 and a molecular weight of 523.68 g/mol. Its IUPAC name is N-[5-(decylsulfinylmethyl)-1,2-oxazol-3-yl]-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide.
| Compound Name | N-[5-(decylsulfinylmethyl)-1,2-oxazol-3-yl]-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 70411262 |
| Molecular Formula | C24H33N3O6S2 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | N-[5-(decylsulfinylmethyl)-1,2-oxazol-3-yl]-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
| SMILES | CCCCCCCCCCS(=O)Cc1cc(NC(=O)C2=C(O)c3ccccc3S(=O)(=O)N2C)no1 |
| InChI | InChI=1S/C24H33N3O6S2/c1-3-4-5-6-7-8-9-12-15-34(30)17-18-16-21(26-33-18)25-24(29)22-23(28)19-13-10-11-14-20(19)35(31,32)27(22)2/h10-11,13-14,16,28H,3-9,12,15,17H2,1-2H3,(H,25,26,29) |
| InChIKey | CEZHFAJLOGVWHG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|