C13H27N2O2+ — CID 56609230
1-hydroxybutyl-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium (PubChem CID 56609230) has the molecular formula C13H27N2O2+ and a molecular weight of 243.37 g/mol. Its IUPAC name is 1-hydroxybutyl-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium.
| Compound Name | 1-hydroxybutyl-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium |
|---|---|
| PubChem CID | 56609230 |
| Molecular Formula | C13H27N2O2+ |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.21 |
| IUPAC Name | 1-hydroxybutyl-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium |
| SMILES | C=C(C)C(=O)NCCC[N+](C)(C)C(O)CCC |
| InChI | InChI=1S/C13H26N2O2/c1-6-8-12(16)15(4,5)10-7-9-14-13(17)11(2)3/h12,16H,2,6-10H2,1,3-5H3/p+1 |
| InChIKey | KOPJFMMSBPQLDM-UHFFFAOYSA-O |
| XLogP | 1.26 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|